C25H32B43INO6 — CID 162243574
CID 162243574 (PubChem CID 162243574) has the molecular formula C25H32B43INO6 and a molecular weight of 1034.35 g/mol.
| Compound Name | CID 162243574 |
|---|---|
| PubChem CID | 162243574 |
| Molecular Formula | C25H32B43INO6 |
| Molecular Weight | 1034.35 g/mol |
| Exact Mass | 1042.53 |
| IUPAC Name | — |
| SMILES | COc1ccc(CCC(=O)CC2c3c(cc4c(c3OC)OCO4)CC[N+]2(C)C)c(OC)c1.[B][B]B([B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].[I-] |
| InChI | InChI=1S/C25H32NO6.B43.HI/c1-26(2)11-10-17-12-22-24(32-15-31-22)25(30-5)23(17)20(26)13-18(27)8-6-16-7-9-19(28-3)14-21(16)29-4;1-23-34(22)40(35(24(2)3)25(4)5)43(41(36(26(6)7)27(8)9)37(28(10)11)29(12)13)42(38(30(14)15)31(16)17)39(32(18)19)33(20)21;/h7,9,12,14,20H,6,8,10-11,13,15H2,1-5H3;;1H/q+1;;/p-1 |
| InChIKey | UUDGLQGTQZSUKH-UHFFFAOYSA-M |
| XLogP | -15.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 76 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.35 |
| LogP ≤ 5 | -15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|