C24H30B58INO6 — CID 159617680
CID 159617680 (PubChem CID 159617680) has the molecular formula C24H30B58INO6 and a molecular weight of 1182.50 g/mol.
| Compound Name | CID 159617680 |
|---|---|
| PubChem CID | 159617680 |
| Molecular Formula | C24H30B58INO6 |
| Molecular Weight | 1182.50 g/mol |
| Exact Mass | 1193.65 |
| IUPAC Name | — |
| SMILES | COc1ccc(OC)c(CC(=O)CC2c3c(cc4c(c3OC)OCO4)CC[N+]2(C)C)c1.[B]B([B])B(B([B])[B])B(B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].[I-] |
| InChI | InChI=1S/C24H30NO6.B58.HI/c1-25(2)9-8-15-12-21-23(31-14-30-21)24(29-5)22(15)19(25)13-17(26)10-16-11-18(27-3)6-7-20(16)28-4;1-31(2)46(32(3)4)53(45(29)30)57(54(47(33(5)6)34(7)8)48(35(9)10)36(11)12)58(55(49(37(13)14)38(15)16)50(39(17)18)40(19)20)56(51(41(21)22)42(23)24)52(43(25)26)44(27)28;/h6-7,11-12,19H,8-10,13-14H2,1-5H3;;1H/q+1;;/p-1 |
| InChIKey | AWPNYMTYEPMFSJ-UHFFFAOYSA-M |
| XLogP | -21.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 90 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1182.50 |
| LogP ≤ 5 | -21.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|