C15H27O5P — CID 158076579
(13-methyl-2,12-dioxotetradec-13-enyl)phosphonic acid (PubChem CID 158076579) has the molecular formula C15H27O5P and a molecular weight of 318.35 g/mol. Its IUPAC name is (13-methyl-2,12-dioxotetradec-13-enyl)phosphonic acid.
| Compound Name | (13-methyl-2,12-dioxotetradec-13-enyl)phosphonic acid |
|---|---|
| PubChem CID | 158076579 |
| Molecular Formula | C15H27O5P |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (13-methyl-2,12-dioxotetradec-13-enyl)phosphonic acid |
| SMILES | C=C(C)C(=O)CCCCCCCCCC(=O)CP(=O)(O)O |
| InChI | InChI=1S/C15H27O5P/c1-13(2)15(17)11-9-7-5-3-4-6-8-10-14(16)12-21(18,19)20/h1,3-12H2,2H3,(H2,18,19,20) |
| InChIKey | NPFJFTQQSALXIH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|