C72H99N9O12 — CID 158077166
1,3,5-tris[8-[4-(4,5-dioxo-5-phenylpentyl)piperazin-1-yl]-8-oxooctyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 158077166) has the molecular formula C72H99N9O12 and a molecular weight of 1282.63 g/mol. Its IUPAC name is 1,3,5-tris[8-[4-(4,5-dioxo-5-phenylpentyl)piperazin-1-yl]-8-oxooctyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[8-[4-(4,5-dioxo-5-phenylpentyl)piperazin-1-yl]-8-oxooctyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 158077166 |
| Molecular Formula | C72H99N9O12 |
| Molecular Weight | 1282.63 g/mol |
| Exact Mass | 1281.74 |
| IUPAC Name | 1,3,5-tris[8-[4-(4,5-dioxo-5-phenylpentyl)piperazin-1-yl]-8-oxooctyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=C(CCCN1CCN(C(=O)CCCCCCCn2c(=O)n(CCCCCCCC(=O)N3CCN(CCCC(=O)C(=O)c4ccccc4)CC3)c(=O)n(CCCCCCCC(=O)N3CCN(CCCC(=O)C(=O)c4ccccc4)CC3)c2=O)CC1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C72H99N9O12/c82-61(67(88)58-28-13-10-14-29-58)34-25-40-73-46-52-76(53-47-73)64(85)37-19-4-1-7-22-43-79-70(91)80(44-23-8-2-5-20-38-65(86)77-54-48-74(49-55-77)41-26-35-62(83)68(89)59-30-15-11-16-31-59)72(93)81(71(79)92)45-24-9-3-6-21-39-66(87)78-56-50-75(51-57-78)42-27-36-63(84)69(90)60-32-17-12-18-33-60/h10-18,28-33H,1-9,19-27,34-57H2 |
| InChIKey | FMNABRUEUUCREA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 239.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1282.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|