C12H27ClN2O4S2 — CID 158077404
2-chloroacetic acid;2-(dimethylamino)ethanethiol;2-[2-(dimethylamino)ethylsulfanyl]acetic acid (PubChem CID 158077404) has the molecular formula C12H27ClN2O4S2 and a molecular weight of 362.95 g/mol. Its IUPAC name is 2-chloroacetic acid;2-(dimethylamino)ethanethiol;2-[2-(dimethylamino)ethylsulfanyl]acetic acid.
| Compound Name | 2-chloroacetic acid;2-(dimethylamino)ethanethiol;2-[2-(dimethylamino)ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 158077404 |
| Molecular Formula | C12H27ClN2O4S2 |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-chloroacetic acid;2-(dimethylamino)ethanethiol;2-[2-(dimethylamino)ethylsulfanyl]acetic acid |
| SMILES | CN(C)CCS.CN(C)CCSCC(=O)O.O=C(O)CCl |
| InChI | InChI=1S/C6H13NO2S.C4H11NS.C2H3ClO2/c1-7(2)3-4-10-5-6(8)9;1-5(2)3-4-6;3-1-2(4)5/h3-5H2,1-2H3,(H,8,9);6H,3-4H2,1-2H3;1H2,(H,4,5) |
| InChIKey | FMNPXGIGRCAIMH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|