C22H26BBrF6N6O4 — CID 158088841
1-(5-bromo-3-pyridinyl)-3-(2,2,2-trifluoroethyl)urea;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 158088841) has the molecular formula C22H26BBrF6N6O4 and a molecular weight of 643.19 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-3-(2,2,2-trifluoroethyl)urea;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(5-bromo-3-pyridinyl)-3-(2,2,2-trifluoroethyl)urea;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 158088841 |
| Molecular Formula | C22H26BBrF6N6O4 |
| Molecular Weight | 643.19 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-3-(2,2,2-trifluoroethyl)urea;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC1(C)OB(c2cncc(NC(=O)NCC(F)(F)F)c2)OC1(C)C.O=C(NCC(F)(F)F)Nc1cncc(Br)c1 |
| InChI | InChI=1S/C14H19BF3N3O3.C8H7BrF3N3O/c1-12(2)13(3,4)24-15(23-12)9-5-10(7-19-6-9)21-11(22)20-8-14(16,17)18;9-5-1-6(3-13-2-5)15-7(16)14-4-8(10,11)12/h5-7H,8H2,1-4H3,(H2,20,21,22);1-3H,4H2,(H2,14,15,16) |
| InChIKey | FNVPJKRAHZNXAH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|