C21H23FN2O5S — CID 158088860
[(1S,2R,4S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate formate (PubChem CID 158088860) has the molecular formula C21H23FN2O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate formate.
| Compound Name | [(1S,2R,4S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate formate |
|---|---|
| PubChem CID | 158088860 |
| Molecular Formula | C21H23FN2O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(1S,2R,4S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate formate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)Nc3ccc(F)cc3-c3cccs3)C[C@H]1[C@H]1O[C@H]12.O=C[O-] |
| InChI | InChI=1S/C20H21FN2O3S.CH2O2/c1-23(2)15-9-12(10-16(23)19-18(15)26-19)25-20(24)22-14-6-5-11(21)8-13(14)17-4-3-7-27-17;2-1-3/h3-8,12,15-16,18-19H,9-10H2,1-2H3;1H,(H,2,3)/t12?,15-,16+,18+,19-; |
| InChIKey | FNVRBBCDWFPGPG-WQSCRKFSSA-N |
| XLogP | 2.23 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|