C41H42N6O10 — CID 158094713
[3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazol-4-yl]methanol;methyl 3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazole-4-carboxylate;oxolane (PubChem CID 158094713) has the molecular formula C41H42N6O10 and a molecular weight of 778.82 g/mol. Its IUPAC name is [3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazol-4-yl]methanol;methyl 3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazole-4-carboxylate;oxolane.
| Compound Name | [3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazol-4-yl]methanol;methyl 3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazole-4-carboxylate;oxolane |
|---|---|
| PubChem CID | 158094713 |
| Molecular Formula | C41H42N6O10 |
| Molecular Weight | 778.82 g/mol |
| Exact Mass | 778.30 |
| IUPAC Name | [3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazol-4-yl]methanol;methyl 3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]imidazole-4-carboxylate;oxolane |
| SMILES | C1CCOC1.COC(=O)c1cncn1Cc1ccc(OC)c(-c2cccc([N+](=O)[O-])c2)c1.COc1ccc(Cn2cncc2CO)cc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N3O5.C18H17N3O4.C4H8O/c1-26-18-7-6-13(11-21-12-20-10-17(21)19(23)27-2)8-16(18)14-4-3-5-15(9-14)22(24)25;1-25-18-6-5-13(10-20-12-19-9-16(20)11-22)7-17(18)14-3-2-4-15(8-14)21(23)24;1-2-4-5-3-1/h3-10,12H,11H2,1-2H3;2-9,12,22H,10-11H2,1H3;1-4H2 |
| InChIKey | FONJPEKMRGBYBN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 196.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.82 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|