About 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one
2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one (PubChem CID 158094894) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one.
Analyze 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one?
The IUPAC name of 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one (CID 158094894) is 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one.
What is the SMILES notation for 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one?
The canonical SMILES for 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one is CC1(C)C2CC3CC4C(=O)OC1C4(C3)C2.
What is the InChIKey of 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one?
The InChIKey is FONYPCXVQGXMBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-12(2)8-3-7-4-9-10(14)15-11(12)13(9,5-7)6-8/h7-9,11H,3-6H2,1-2H3.
What are the key properties of 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one?
2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one has a molecular weight of 206.28 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-oxatetracyclo[6.3.1.03,10.06,10]dodecan-5-one is sourced from PubChem (CID 158094894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).