About 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one
11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one (PubChem CID 22297606) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one.
Molecular Properties
| Compound Name | 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one |
| PubChem CID | 22297606 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one |
| SMILES | CC1(C)C2CC(O)C3(CSCC(=O)OC13)C2 |
| InChI | InChI=1S/C12H18O3S/c1-11(2)7-3-8(13)12(4-7)6-16-5-9(14)15-10(11)12/h7-8,10,13H,3-6H2,1-2H3 |
| InChIKey | MZQJTYOGJWZLAA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one?
The IUPAC name of 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one (CID 22297606) is 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one.
What is the SMILES notation for 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one?
The canonical SMILES for 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one is CC1(C)C2CC(O)C3(CSCC(=O)OC13)C2.
What is the InChIKey of 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one?
The InChIKey is MZQJTYOGJWZLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-11(2)7-3-8(13)12(4-7)6-16-5-9(14)15-10(11)12/h7-8,10,13H,3-6H2,1-2H3.
What are the key properties of 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one?
11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one has a molecular weight of 242.34 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxy-8,8-dimethyl-6-oxa-3-thiatricyclo[7.2.1.01,7]dodecan-5-one is sourced from PubChem (CID 22297606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).