C25H27N5O2 — CID 158097375
(E)-1-[4-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]hex-2-en-1-one (PubChem CID 158097375) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (E)-1-[4-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]hex-2-en-1-one.
| Compound Name | (E)-1-[4-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]hex-2-en-1-one |
|---|---|
| PubChem CID | 158097375 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-1-[4-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]hex-2-en-1-one |
| SMILES | CCC/C=C/C(=O)N1CCN(c2ncnc3[nH]c(C#CCOc4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C25H27N5O2/c1-2-3-5-12-23(31)29-13-15-30(16-14-29)25-22-18-20(28-24(22)26-19-27-25)9-8-17-32-21-10-6-4-7-11-21/h4-7,10-12,18-19H,2-3,13-17H2,1H3,(H,26,27,28)/b12-5+ |
| InChIKey | QPOVFCJBMXSAFT-LFYBBSHMSA-N |
| XLogP | 3.39 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|