C24H28N6O2 — CID 123153990
1-[4-[6-(3-cyclohexa-1,3-dien-1-yloxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-4-(methylamino)but-2-en-1-one (PubChem CID 123153990) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[4-[6-(3-cyclohexa-1,3-dien-1-yloxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-4-(methylamino)but-2-en-1-one.
| Compound Name | 1-[4-[6-(3-cyclohexa-1,3-dien-1-yloxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-4-(methylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 123153990 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[4-[6-(3-cyclohexa-1,3-dien-1-yloxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-4-(methylamino)but-2-en-1-one |
| SMILES | CNCC=CC(=O)N1CCN(c2ncnc3[nH]c(C#CCOC4=CC=CCC4)cc23)CC1 |
| InChI | InChI=1S/C24H28N6O2/c1-25-11-5-10-22(31)29-12-14-30(15-13-29)24-21-17-19(28-23(21)26-18-27-24)7-6-16-32-20-8-3-2-4-9-20/h2-3,5,8,10,17-18,25H,4,9,11-16H2,1H3,(H,26,27,28) |
| InChIKey | HMBCGMIZWCGGRL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|