C22H13ClN2O5S — CID 158098192
5-[2-chloro-5-[(2-cyanophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 158098192) has the molecular formula C22H13ClN2O5S and a molecular weight of 452.88 g/mol. Its IUPAC name is 5-[2-chloro-5-[(2-cyanophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-[(2-cyanophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158098192 |
| Molecular Formula | C22H13ClN2O5S |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 5-[2-chloro-5-[(2-cyanophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | N#Cc1ccccc1COc1ccc(Cl)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1 |
| InChI | InChI=1S/C22H13ClN2O5S/c23-16-6-5-15(30-10-13-4-2-1-3-12(13)9-24)8-17(16)25-18(26)7-14-11-31-20(22(28)29)19(14)21(25)27/h1-6,8,11H,7,10H2,(H,28,29) |
| InChIKey | FOXQGQFQEGVAAJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|