C23H18FNO7S — CID 160735467
5-[5-[(2,5-dimethoxyphenyl)methoxy]-2-fluorophenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 160735467) has the molecular formula C23H18FNO7S and a molecular weight of 471.46 g/mol. Its IUPAC name is 5-[5-[(2,5-dimethoxyphenyl)methoxy]-2-fluorophenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[5-[(2,5-dimethoxyphenyl)methoxy]-2-fluorophenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 160735467 |
| Molecular Formula | C23H18FNO7S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 5-[5-[(2,5-dimethoxyphenyl)methoxy]-2-fluorophenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | COc1ccc(OC)c(COc2ccc(F)c(N3C(=O)Cc4csc(C(=O)O)c4C3=O)c2)c1 |
| InChI | InChI=1S/C23H18FNO7S/c1-30-14-4-6-18(31-2)12(7-14)10-32-15-3-5-16(24)17(9-15)25-19(26)8-13-11-33-21(23(28)29)20(13)22(25)27/h3-7,9,11H,8,10H2,1-2H3,(H,28,29) |
| InChIKey | RUWRVDPCXNZWSS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|