C23H18FNO6S — CID 164952009
5-[2-fluoro-5-[1-(2-methoxyphenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 164952009) has the molecular formula C23H18FNO6S and a molecular weight of 455.46 g/mol. Its IUPAC name is 5-[2-fluoro-5-[1-(2-methoxyphenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-fluoro-5-[1-(2-methoxyphenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164952009 |
| Molecular Formula | C23H18FNO6S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 5-[2-fluoro-5-[1-(2-methoxyphenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | COc1ccccc1C(C)Oc1ccc(F)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1 |
| InChI | InChI=1S/C23H18FNO6S/c1-12(15-5-3-4-6-18(15)30-2)31-14-7-8-16(24)17(10-14)25-19(26)9-13-11-32-21(23(28)29)20(13)22(25)27/h3-8,10-12H,9H2,1-2H3,(H,28,29) |
| InChIKey | AQTQLDPENDONHT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|