C21H12Cl3NO5S — CID 159970384
5-[2-chloro-5-[(2,5-dichlorophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 159970384) has the molecular formula C21H12Cl3NO5S and a molecular weight of 496.76 g/mol. Its IUPAC name is 5-[2-chloro-5-[(2,5-dichlorophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-[(2,5-dichlorophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159970384 |
| Molecular Formula | C21H12Cl3NO5S |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 494.95 |
| IUPAC Name | 5-[2-chloro-5-[(2,5-dichlorophenyl)methoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1scc2c1C(=O)N(c1cc(OCc3cc(Cl)ccc3Cl)ccc1Cl)C(=O)C2 |
| InChI | InChI=1S/C21H12Cl3NO5S/c22-12-1-3-14(23)10(5-12)8-30-13-2-4-15(24)16(7-13)25-17(26)6-11-9-31-19(21(28)29)18(11)20(25)27/h1-5,7,9H,6,8H2,(H,28,29) |
| InChIKey | OELUQROPCIDSMT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|