C24H18ClNO5S — CID 164955660
5-[2-chloro-5-(2-methyl-2-phenylpropanoyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 164955660) has the molecular formula C24H18ClNO5S and a molecular weight of 467.93 g/mol. Its IUPAC name is 5-[2-chloro-5-(2-methyl-2-phenylpropanoyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-(2-methyl-2-phenylpropanoyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164955660 |
| Molecular Formula | C24H18ClNO5S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 5-[2-chloro-5-(2-methyl-2-phenylpropanoyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C(=O)c1ccc(Cl)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C24H18ClNO5S/c1-24(2,15-6-4-3-5-7-15)21(28)13-8-9-16(25)17(10-13)26-18(27)11-14-12-32-20(23(30)31)19(14)22(26)29/h3-10,12H,11H2,1-2H3,(H,30,31) |
| InChIKey | BDCSDCCFSAJIJB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|