C20H14ClN3O6S2 — CID 164968009
5-[2-chloro-5-[methyl(pyridin-4-yl)sulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 164968009) has the molecular formula C20H14ClN3O6S2 and a molecular weight of 491.93 g/mol. Its IUPAC name is 5-[2-chloro-5-[methyl(pyridin-4-yl)sulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-[methyl(pyridin-4-yl)sulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164968009 |
| Molecular Formula | C20H14ClN3O6S2 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 5-[2-chloro-5-[methyl(pyridin-4-yl)sulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | CN(c1ccncc1)S(=O)(=O)c1ccc(Cl)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1 |
| InChI | InChI=1S/C20H14ClN3O6S2/c1-23(12-4-6-22-7-5-12)32(29,30)13-2-3-14(21)15(9-13)24-16(25)8-11-10-31-18(20(27)28)17(11)19(24)26/h2-7,9-10H,8H2,1H3,(H,27,28) |
| InChIKey | CSTITOVFERRBBJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|