C21H13ClF2N2O6S2 — CID 164991365
5-[2-chloro-5-[(2,4-difluorophenyl)-methylsulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 164991365) has the molecular formula C21H13ClF2N2O6S2 and a molecular weight of 526.93 g/mol. Its IUPAC name is 5-[2-chloro-5-[(2,4-difluorophenyl)-methylsulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-[(2,4-difluorophenyl)-methylsulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164991365 |
| Molecular Formula | C21H13ClF2N2O6S2 |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 5-[2-chloro-5-[(2,4-difluorophenyl)-methylsulfamoyl]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | CN(c1ccc(F)cc1F)S(=O)(=O)c1ccc(Cl)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1 |
| InChI | InChI=1S/C21H13ClF2N2O6S2/c1-25(15-5-2-11(23)7-14(15)24)34(31,32)12-3-4-13(22)16(8-12)26-17(27)6-10-9-33-19(21(29)30)18(10)20(26)28/h2-5,7-9H,6H2,1H3,(H,29,30) |
| InChIKey | GXCZVTVJTPZGAX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|