C22H14Cl3NO5S — CID 159678018
5-[2-chloro-5-[1-(2,6-dichlorophenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 159678018) has the molecular formula C22H14Cl3NO5S and a molecular weight of 510.78 g/mol. Its IUPAC name is 5-[2-chloro-5-[1-(2,6-dichlorophenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-[1-(2,6-dichlorophenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159678018 |
| Molecular Formula | C22H14Cl3NO5S |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | 5-[2-chloro-5-[1-(2,6-dichlorophenyl)ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | CC(Oc1ccc(Cl)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H14Cl3NO5S/c1-10(18-14(24)3-2-4-15(18)25)31-12-5-6-13(23)16(8-12)26-17(27)7-11-9-32-20(22(29)30)19(11)21(26)28/h2-6,8-10H,7H2,1H3,(H,29,30) |
| InChIKey | MUVWYRPNGDBBOI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|