C38H45N5O4 — CID 158098464
ethyl 3-[(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate;4-piperidin-4-yl-1,3-dihydroindol-2-one (PubChem CID 158098464) has the molecular formula C38H45N5O4 and a molecular weight of 635.81 g/mol. Its IUPAC name is ethyl 3-[(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate;4-piperidin-4-yl-1,3-dihydroindol-2-one.
| Compound Name | ethyl 3-[(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate;4-piperidin-4-yl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 158098464 |
| Molecular Formula | C38H45N5O4 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | ethyl 3-[(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate;4-piperidin-4-yl-1,3-dihydroindol-2-one |
| SMILES | CCOC(=O)c1[nH]c(C=C2C(=O)Nc3cccc(C4CCNCC4)c32)c2c1CCCC2.O=C1Cc2c(cccc2C2CCNCC2)N1 |
| InChI | InChI=1S/C25H29N3O3.C13H16N2O/c1-2-31-25(30)23-18-7-4-3-6-17(18)21(27-23)14-19-22-16(15-10-12-26-13-11-15)8-5-9-20(22)28-24(19)29;16-13-8-11-10(2-1-3-12(11)15-13)9-4-6-14-7-5-9/h5,8-9,14-15,26-27H,2-4,6-7,10-13H2,1H3,(H,28,29);1-3,9,14H,4-8H2,(H,15,16) |
| InChIKey | FOYMIHWCCXWXJJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|