C24H30N6O5 — CID 158108245
7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-3H-1,3-benzoxazol-2-one;7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 158108245) has the molecular formula C24H30N6O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-3H-1,3-benzoxazol-2-one;7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-3H-1,3-benzoxazol-2-one;7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 158108245 |
| Molecular Formula | C24H30N6O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-3H-1,3-benzoxazol-2-one;7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | CN1CCN(c2cccc3[nH]c(=O)oc23)CC1.C[N+]1([O-])CCN(c2cccc3[nH]c(=O)oc23)CC1 |
| InChI | InChI=1S/C12H15N3O3.C12H15N3O2/c1-15(17)7-5-14(6-8-15)10-4-2-3-9-11(10)18-12(16)13-9;1-14-5-7-15(8-6-14)10-4-2-3-9-11(10)17-12(16)13-9/h2-4H,5-8H2,1H3,(H,13,16);2-4H,5-8H2,1H3,(H,13,16) |
| InChIKey | FQCGPWADCVCGPZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|