C24H29FN2O5 — CID 158108859
N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-2-fluorobenzamide (PubChem CID 158108859) has the molecular formula C24H29FN2O5 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-2-fluorobenzamide.
| Compound Name | N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 158108859 |
| Molecular Formula | C24H29FN2O5 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-2-fluorobenzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2F)c(C(=O)CCCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H29FN2O5/c1-30-22-15-18(21(28)9-5-6-10-27-11-13-32-14-12-27)20(16-23(22)31-2)26-24(29)17-7-3-4-8-19(17)25/h3-4,7-8,15-16H,5-6,9-14H2,1-2H3,(H,26,29) |
| InChIKey | FQECYJRBGCCTON-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|