C57H48O6S3 — CID 158109115
4-phenyl-1-thiophen-2-yl-5,6,7,8-tetrahydroisochromen-3-one (PubChem CID 158109115) has the molecular formula C57H48O6S3 and a molecular weight of 925.21 g/mol. Its IUPAC name is 4-phenyl-1-thiophen-2-yl-5,6,7,8-tetrahydroisochromen-3-one.
| Compound Name | 4-phenyl-1-thiophen-2-yl-5,6,7,8-tetrahydroisochromen-3-one |
|---|---|
| PubChem CID | 158109115 |
| Molecular Formula | C57H48O6S3 |
| Molecular Weight | 925.21 g/mol |
| Exact Mass | 924.26 |
| IUPAC Name | 4-phenyl-1-thiophen-2-yl-5,6,7,8-tetrahydroisochromen-3-one |
| SMILES | O=c1oc(-c2cccs2)c2c(c1-c1ccccc1)CCCC2.O=c1oc(-c2cccs2)c2c(c1-c1ccccc1)CCCC2.O=c1oc(-c2cccs2)c2c(c1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/3C19H16O2S/c3*20-19-17(13-7-2-1-3-8-13)14-9-4-5-10-15(14)18(21-19)16-11-6-12-22-16/h3*1-3,6-8,11-12H,4-5,9-10H2 |
| InChIKey | FQEVULROFFMUGS-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.21 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |