C20H23NO10 — CID 158112474
methyl 3,4-bis(trideuteriomethoxy)benzoate;methyl 2-nitro-4,5-bis(trideuteriomethoxy)benzoate (PubChem CID 158112474) has the molecular formula C20H23NO10 and a molecular weight of 449.47 g/mol. Its IUPAC name is methyl 3,4-bis(trideuteriomethoxy)benzoate;methyl 2-nitro-4,5-bis(trideuteriomethoxy)benzoate.
| Compound Name | methyl 3,4-bis(trideuteriomethoxy)benzoate;methyl 2-nitro-4,5-bis(trideuteriomethoxy)benzoate |
|---|---|
| PubChem CID | 158112474 |
| Molecular Formula | C20H23NO10 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | methyl 3,4-bis(trideuteriomethoxy)benzoate;methyl 2-nitro-4,5-bis(trideuteriomethoxy)benzoate |
| SMILES | [2H]C([2H])([2H])Oc1cc(C(=O)OC)c([N+](=O)[O-])cc1OC([2H])([2H])[2H].[2H]C([2H])([2H])Oc1ccc(C(=O)OC)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C10H11NO6.C10H12O4/c1-15-8-4-6(10(12)17-3)7(11(13)14)5-9(8)16-2;1-12-8-5-4-7(10(11)14-3)6-9(8)13-2/h4-5H,1-3H3;4-6H,1-3H3/i2*1D3,2D3 |
| InChIKey | FQPIVNWTVSGDNJ-RLNBIOQVSA-N |
| XLogP | 2.89 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|