C24H42N4O5V — CID 158115764
5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one;(1R,2S,3R)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;vanadium (PubChem CID 158115764) has the molecular formula C24H42N4O5V and a molecular weight of 517.57 g/mol. Its IUPAC name is 5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one;(1R,2S,3R)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;vanadium.
| Compound Name | 5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one;(1R,2S,3R)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;vanadium |
|---|---|
| PubChem CID | 158115764 |
| Molecular Formula | C24H42N4O5V |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one;(1R,2S,3R)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;vanadium |
| SMILES | CCC(C)[C@@H](C)[C@@H](C)C(N=[N+]=[N-])C1CCC(=O)O1.C[C@H]1[C@@H](C)C2C(O)CCC(=O)N2[C@H]1CO.[V] |
| InChI | InChI=1S/C13H23N3O2.C11H19NO3.V/c1-5-8(2)9(3)10(4)13(15-16-14)11-6-7-12(17)18-11;1-6-7(2)11-9(14)3-4-10(15)12(11)8(6)5-13;/h8-11,13H,5-7H2,1-4H3;6-9,11,13-14H,3-5H2,1-2H3;/t8?,9-,10-,11?,13?;6-,7+,8-,9?,11?;/m10./s1 |
| InChIKey | FQZFZUNURSXFIS-XQLAEHHSSA-N |
| XLogP | 3.67 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|