C29H55NO5Si3 — CID 158116007
(3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one;triethylsilyl 2-triethylsilyloxyacetate (PubChem CID 158116007) has the molecular formula C29H55NO5Si3 and a molecular weight of 582.02 g/mol. Its IUPAC name is (3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one;triethylsilyl 2-triethylsilyloxyacetate.
| Compound Name | (3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one;triethylsilyl 2-triethylsilyloxyacetate |
|---|---|
| PubChem CID | 158116007 |
| Molecular Formula | C29H55NO5Si3 |
| Molecular Weight | 582.02 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | (3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one;triethylsilyl 2-triethylsilyloxyacetate |
| SMILES | CC[Si](CC)(CC)OCC(=O)O[Si](CC)(CC)CC.CC[Si](CC)(CC)O[C@H]1C(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H23NO2Si.C14H32O3Si2/c1-4-19(5-2,6-3)18-14-13(16-15(14)17)12-10-8-7-9-11-12;1-7-18(8-2,9-3)16-13-14(15)17-19(10-4,11-5)12-6/h7-11,13-14H,4-6H2,1-3H3,(H,16,17);7-13H2,1-6H3/t13-,14+;/m0./s1 |
| InChIKey | FQZVNAXSCHOGJB-LMRHVHIWSA-N |
| XLogP | 7.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.02 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|