C39H40F7O6S+ — CID 158116234
2,2-difluoropropyl 4-(3,3,4,4,4-pentafluorobutanoyloxymethyl)spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate;triphenylsulfanium (PubChem CID 158116234) has the molecular formula C39H40F7O6S+ and a molecular weight of 769.80 g/mol. Its IUPAC name is 2,2-difluoropropyl 4-(3,3,4,4,4-pentafluorobutanoyloxymethyl)spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate;triphenylsulfanium.
| Compound Name | 2,2-difluoropropyl 4-(3,3,4,4,4-pentafluorobutanoyloxymethyl)spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 158116234 |
| Molecular Formula | C39H40F7O6S+ |
| Molecular Weight | 769.80 g/mol |
| Exact Mass | 769.24 |
| IUPAC Name | 2,2-difluoropropyl 4-(3,3,4,4,4-pentafluorobutanoyloxymethyl)spiro[1,3-dioxolane-2,4'-adamantane]-1'-carboxylate;triphenylsulfanium |
| SMILES | CC(F)(F)COC(=O)C12CC3CC(C1)C1(OCC(COC(=O)CC(F)(F)C(F)(F)F)O1)C(C3)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25F7O6.C18H15S/c1-17(22,23)10-32-16(30)18-4-11-2-12(5-18)20(13(3-11)6-18)33-9-14(34-20)8-31-15(29)7-19(24,25)21(26,27)28;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h11-14H,2-10H2,1H3;1-15H/q;+1 |
| InChIKey | FRAORUOOTWJLJW-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.80 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|