C33H34F5O2S+ — CID 157152627
1,1,1,3,3-pentafluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium (PubChem CID 157152627) has the molecular formula C33H34F5O2S+ and a molecular weight of 589.69 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium.
| Compound Name | 1,1,1,3,3-pentafluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 157152627 |
| Molecular Formula | C33H34F5O2S+ |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 1,1,1,3,3-pentafluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium |
| SMILES | CC(F)(F)C(OC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H19F5O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13(16,17)11(15(18,19)20)22-12(21)14-5-8-2-9(6-14)4-10(3-8)7-14/h1-15H;8-11H,2-7H2,1H3/q+1; |
| InChIKey | ALKVWPSMZDWRKC-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|