C31H32F2O2S — CID 67529873
[2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate (PubChem CID 67529873) has the molecular formula C31H32F2O2S and a molecular weight of 506.66 g/mol. Its IUPAC name is [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate.
| Compound Name | [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 67529873 |
| Molecular Formula | C31H32F2O2S |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate |
| SMILES | O=C(OC(C(F)F)S(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H32F2O2S/c32-28(33)29(35-30(34)31-19-22-16-23(20-31)18-24(17-22)21-31)36(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,22-24,28-29H,16-21H2 |
| InChIKey | OIEJMWTYGPXKCI-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |