About [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate
[2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate (PubChem CID 67529873) has the molecular formula C31H32F2O2S
and a molecular weight of 506.66 g/mol. Its IUPAC name is [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate |
| PubChem CID | 67529873 |
| Molecular Formula | C31H32F2O2S |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate |
| SMILES | O=C(OC(C(F)F)S(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H32F2O2S/c32-28(33)29(35-30(34)31-19-22-16-23(20-31)18-24(17-22)21-31)36(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,22-24,28-29H,16-21H2 |
| InChIKey | OIEJMWTYGPXKCI-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate?
The IUPAC name of [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate (CID 67529873) is [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate.
What is the SMILES notation for [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate?
The canonical SMILES for [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate is O=C(OC(C(F)F)S(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate?
The InChIKey is OIEJMWTYGPXKCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32F2O2S/c32-28(33)29(35-30(34)31-19-22-16-23(20-31)18-24(17-22)21-31)36(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,22-24,28-29H,16-21H2.
What are the key properties of [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate?
[2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate has a molecular weight of 506.66 g/mol, XLogP of 8.32, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-1-(triphenyl-λ4-sulfanyl)ethyl] adamantane-1-carboxylate is sourced from PubChem (CID 67529873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).