C35H33F7O7S2 — CID 86678061
1,1,2,2-tetrafluoro-4-[3-(2,2,2-trifluoroacetyl)oxyadamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium (PubChem CID 86678061) has the molecular formula C35H33F7O7S2 and a molecular weight of 762.76 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[3-(2,2,2-trifluoroacetyl)oxyadamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2-tetrafluoro-4-[3-(2,2,2-trifluoroacetyl)oxyadamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86678061 |
| Molecular Formula | C35H33F7O7S2 |
| Molecular Weight | 762.76 g/mol |
| Exact Mass | 762.16 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[3-(2,2,2-trifluoroacetyl)oxyadamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium |
| SMILES | O=C(OC12CC3CC(C1)CC(C(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C3)C2)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C17H19F7O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;18-15(19,17(23,24)32(27,28)29)1-2-30-11(25)13-4-9-3-10(5-13)7-14(6-9,8-13)31-12(26)16(20,21)22/h1-15H;9-10H,1-8H2,(H,27,28,29)/q+1;/p-1 |
| InChIKey | RKPPLFVVFAJJND-UHFFFAOYSA-M |
| XLogP | 7.92 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|