C35H36F2O7S2 — CID 86613394
1,1-difluoro-2-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]methoxy]-2-oxoethanesulfonate;triphenylsulfanium (PubChem CID 86613394) has the molecular formula C35H36F2O7S2 and a molecular weight of 670.80 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]methoxy]-2-oxoethanesulfonate;triphenylsulfanium.
| Compound Name | 1,1-difluoro-2-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]methoxy]-2-oxoethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86613394 |
| Molecular Formula | C35H36F2O7S2 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | 1,1-difluoro-2-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]methoxy]-2-oxoethanesulfonate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OC12CC3CC(CC(COC(=O)C(F)(F)S(=O)(=O)[O-])(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C17H22F2O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10(2)13(20)26-16-6-11-3-12(7-16)5-15(4-11,8-16)9-25-14(21)17(18,19)27(22,23)24/h1-15H;11-12H,1,3-9H2,2H3,(H,22,23,24)/q+1;/p-1 |
| InChIKey | JIHIFGFCWXKADK-UHFFFAOYSA-M |
| XLogP | 6.91 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|