C32H34F2O2S — CID 66899081
1-adamantylmethyl 2,2-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate (PubChem CID 66899081) has the molecular formula C32H34F2O2S and a molecular weight of 520.69 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate.
| Compound Name | 1-adamantylmethyl 2,2-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate |
|---|---|
| PubChem CID | 66899081 |
| Molecular Formula | C32H34F2O2S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)CS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34F2O2S/c33-32(34,30(35)36-22-31-19-24-16-25(20-31)18-26(17-24)21-31)23-37(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-15,24-26H,16-23H2 |
| InChIKey | DRASTFCOMASYCJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |