C31H30F2O6S2 — CID 86632757
1,1-difluoro-2-(4-oxoadamantane-1-carbonyl)oxyethanesulfonate;triphenylsulfanium (PubChem CID 86632757) has the molecular formula C31H30F2O6S2 and a molecular weight of 600.71 g/mol. Its IUPAC name is 1,1-difluoro-2-(4-oxoadamantane-1-carbonyl)oxyethanesulfonate;triphenylsulfanium.
| Compound Name | 1,1-difluoro-2-(4-oxoadamantane-1-carbonyl)oxyethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86632757 |
| Molecular Formula | C31H30F2O6S2 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 1,1-difluoro-2-(4-oxoadamantane-1-carbonyl)oxyethanesulfonate;triphenylsulfanium |
| SMILES | O=C1C2CC3CC1CC(C(=O)OCC(F)(F)S(=O)(=O)[O-])(C3)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H16F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;14-13(15,22(18,19)20)6-21-11(17)12-3-7-1-8(4-12)10(16)9(2-7)5-12/h1-15H;7-9H,1-6H2,(H,18,19,20)/q+1;/p-1 |
| InChIKey | WMEJHWGSFMYBGT-UHFFFAOYSA-M |
| XLogP | 5.84 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|