C27H37BN2O4 — CID 158117409
tert-butyl (1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 158117409) has the molecular formula C27H37BN2O4 and a molecular weight of 464.42 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 158117409 |
| Molecular Formula | C27H37BN2O4 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C27H37BN2O4/c1-25(2,3)32-24(31)30-21-13-10-18(14-21)23(30)22-15-19(16-29-22)17-8-11-20(12-9-17)28-33-26(4,5)27(6,7)34-28/h8-9,11-12,16,18,21,23H,10,13-15H2,1-7H3/t18-,21+,23-/m0/s1 |
| InChIKey | GNSXOEOLMFBKHV-ZEYPLWLESA-N |
| XLogP | 4.96 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|