C16H20 — CID 15811833
5,12-dimethylidenecyclotetradeca-1,8-diyne (PubChem CID 15811833) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 5,12-dimethylidenecyclotetradeca-1,8-diyne.
| Compound Name | 5,12-dimethylidenecyclotetradeca-1,8-diyne |
|---|---|
| PubChem CID | 15811833 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5,12-dimethylidenecyclotetradeca-1,8-diyne |
| SMILES | C=C1CCC#CCCC(=C)CCC#CCC1 |
| InChI | InChI=1S/C16H20/c1-15-11-7-3-5-9-13-16(2)14-10-6-4-8-12-15/h1-2,7-14H2 |
| InChIKey | WHQNQDARXHKNER-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|