C12H18BFO — CID 158120577
[2-(2,2-dimethylpropyl)-5-fluorophenyl]-methylborinic acid (PubChem CID 158120577) has the molecular formula C12H18BFO and a molecular weight of 208.09 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)-5-fluorophenyl]-methylborinic acid.
| Compound Name | [2-(2,2-dimethylpropyl)-5-fluorophenyl]-methylborinic acid |
|---|---|
| PubChem CID | 158120577 |
| Molecular Formula | C12H18BFO |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | [2-(2,2-dimethylpropyl)-5-fluorophenyl]-methylborinic acid |
| SMILES | CB(O)c1cc(F)ccc1CC(C)(C)C |
| InChI | InChI=1S/C12H18BFO/c1-12(2,3)8-9-5-6-10(14)7-11(9)13(4)15/h5-7,15H,8H2,1-4H3 |
| InChIKey | SWAPPVXIXVHWCT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|