C35H39N9O6 — CID 158121214
bis(1-(cyclohexylmethyl)-5-nitroindazole);5-nitro-1H-indazole (PubChem CID 158121214) has the molecular formula C35H39N9O6 and a molecular weight of 681.75 g/mol. Its IUPAC name is bis(1-(cyclohexylmethyl)-5-nitroindazole);5-nitro-1H-indazole.
| Compound Name | bis(1-(cyclohexylmethyl)-5-nitroindazole);5-nitro-1H-indazole |
|---|---|
| PubChem CID | 158121214 |
| Molecular Formula | C35H39N9O6 |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.30 |
| IUPAC Name | bis(1-(cyclohexylmethyl)-5-nitroindazole);5-nitro-1H-indazole |
| SMILES | O=[N+]([O-])c1ccc2[nH]ncc2c1.O=[N+]([O-])c1ccc2c(cnn2CC2CCCCC2)c1.O=[N+]([O-])c1ccc2c(cnn2CC2CCCCC2)c1 |
| InChI | InChI=1S/2C14H17N3O2.C7H5N3O2/c2*18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11;11-10(12)6-1-2-7-5(3-6)4-8-9-7/h2*6-9,11H,1-5,10H2;1-4H,(H,8,9) |
| InChIKey | FRPXAGXMXVYNHJ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 193.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|