C25H30N5OY- — CID 158123394
N-[3-[[2-(anilino)-5-methylpyrimidin-4-yl]amino]phenyl]-2,2,3,3-tetramethylbutanamide;yttrium (PubChem CID 158123394) has the molecular formula C25H30N5OY- and a molecular weight of 505.46 g/mol. Its IUPAC name is N-[3-[[2-(anilino)-5-methylpyrimidin-4-yl]amino]phenyl]-2,2,3,3-tetramethylbutanamide;yttrium.
| Compound Name | N-[3-[[2-(anilino)-5-methylpyrimidin-4-yl]amino]phenyl]-2,2,3,3-tetramethylbutanamide;yttrium |
|---|---|
| PubChem CID | 158123394 |
| Molecular Formula | C25H30N5OY- |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[3-[[2-(anilino)-5-methylpyrimidin-4-yl]amino]phenyl]-2,2,3,3-tetramethylbutanamide;yttrium |
| SMILES | Cc1cnc(Nc2cc[c-]cc2)nc1Nc1cccc(NC(=O)C(C)(C)C(C)(C)C)c1.[Y] |
| InChI | InChI=1S/C25H30N5O.Y/c1-17-16-26-23(29-18-11-8-7-9-12-18)30-21(17)27-19-13-10-14-20(15-19)28-22(31)25(5,6)24(2,3)4;/h8-16H,1-6H3,(H,28,31)(H2,26,27,29,30);/q-1; |
| InChIKey | UTJXZDYXQWSRHD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|