C12H18I2O — CID 15812678
(1R,2S,3S,6R,7R,10R)-10-iodo-7-(iodomethyl)-3-methyltricyclo[5.3.0.02,6]decan-3-ol (PubChem CID 15812678) has the molecular formula C12H18I2O and a molecular weight of 432.08 g/mol. Its IUPAC name is (1R,2S,3S,6R,7R,10R)-10-iodo-7-(iodomethyl)-3-methyltricyclo[5.3.0.02,6]decan-3-ol.
| Compound Name | (1R,2S,3S,6R,7R,10R)-10-iodo-7-(iodomethyl)-3-methyltricyclo[5.3.0.02,6]decan-3-ol |
|---|---|
| PubChem CID | 15812678 |
| Molecular Formula | C12H18I2O |
| Molecular Weight | 432.08 g/mol |
| Exact Mass | 431.94 |
| IUPAC Name | (1R,2S,3S,6R,7R,10R)-10-iodo-7-(iodomethyl)-3-methyltricyclo[5.3.0.02,6]decan-3-ol |
| SMILES | C[C@]1(O)CC[C@@H]2[C@H]1[C@H]1[C@H](I)CC[C@]12CI |
| InChI | InChI=1S/C12H18I2O/c1-11(15)4-2-7-9(11)10-8(14)3-5-12(7,10)6-13/h7-10,15H,2-6H2,1H3/t7-,8-,9+,10-,11+,12-/m1/s1 |
| InChIKey | JAYUQMQGRZNBAG-XZPZHEHLSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.08 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|