C9H18O — CID 171582108
trans-(1R,2R)-2-tert-butyl-1-methylcyclobutan-1-ol (PubChem CID 171582108) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is trans-(1R,2R)-2-tert-butyl-1-methylcyclobutan-1-ol.
| Compound Name | trans-(1R,2R)-2-tert-butyl-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 171582108 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | trans-(1R,2R)-2-tert-butyl-1-methylcyclobutan-1-ol |
| SMILES | CC(C)(C)[C@H]1CC[C@@]1(C)O |
| InChI | InChI=1S/C9H18O/c1-8(2,3)7-5-6-9(7,4)10/h7,10H,5-6H2,1-4H3/t7-,9-/m1/s1 |
| InChIKey | QTXSEGYXRQVXMS-VXNVDRBHSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |