C25H45N5O5 — CID 158129543
tert-butyl 5-(5-aminopyrazol-1-yl)pentanoate;tert-butyl 5-oxopentanoate;but-3-ynylhydrazine (PubChem CID 158129543) has the molecular formula C25H45N5O5 and a molecular weight of 495.67 g/mol. Its IUPAC name is tert-butyl 5-(5-aminopyrazol-1-yl)pentanoate;tert-butyl 5-oxopentanoate;but-3-ynylhydrazine.
| Compound Name | tert-butyl 5-(5-aminopyrazol-1-yl)pentanoate;tert-butyl 5-oxopentanoate;but-3-ynylhydrazine |
|---|---|
| PubChem CID | 158129543 |
| Molecular Formula | C25H45N5O5 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.34 |
| IUPAC Name | tert-butyl 5-(5-aminopyrazol-1-yl)pentanoate;tert-butyl 5-oxopentanoate;but-3-ynylhydrazine |
| SMILES | C#CCCNN.CC(C)(C)OC(=O)CCCC=O.CC(C)(C)OC(=O)CCCCn1nccc1N |
| InChI | InChI=1S/C12H21N3O2.C9H16O3.C4H8N2/c1-12(2,3)17-11(16)6-4-5-9-15-10(13)7-8-14-15;1-9(2,3)12-8(11)6-4-5-7-10;1-2-3-4-6-5/h7-8H,4-6,9,13H2,1-3H3;7H,4-6H2,1-3H3;1,6H,3-5H2 |
| InChIKey | FSPHNIQYEGZKBS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 151.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|