C30H47N5O6 — CID 158131526
(2S,5S)-5-[[(2R)-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-2-(hydroxymethyl)-6-methyl-N-[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]-4-oxoheptanamide (PubChem CID 158131526) has the molecular formula C30H47N5O6 and a molecular weight of 573.74 g/mol. Its IUPAC name is (2S,5S)-5-[[(2R)-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-2-(hydroxymethyl)-6-methyl-N-[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]-4-oxoheptanamide.
| Compound Name | (2S,5S)-5-[[(2R)-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-2-(hydroxymethyl)-6-methyl-N-[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]-4-oxoheptanamide |
|---|---|
| PubChem CID | 158131526 |
| Molecular Formula | C30H47N5O6 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | (2S,5S)-5-[[(2R)-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-2-(hydroxymethyl)-6-methyl-N-[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]-4-oxoheptanamide |
| SMILES | CC(=O)C[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)C[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C30H47N5O6/c1-18(2)26(35-28(40)22(14-20(5)37)12-9-13-33-30(31)32)25(38)16-23(17-36)29(41)34-24(27(39)19(3)4)15-21-10-7-6-8-11-21/h6-8,10-11,18-19,22-24,26,36H,9,12-17H2,1-5H3,(H,34,41)(H,35,40)(H4,31,32,33)/t22-,23+,24+,26+/m1/s1 |
| InChIKey | PMZSLJJQVMOFPF-APFRJGHOSA-N |
| XLogP | 1.30 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|