C19H20F4O3S — CID 158134110
1-fluoro-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]-2-(trifluoromethoxy)benzene (PubChem CID 158134110) has the molecular formula C19H20F4O3S and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-fluoro-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1-fluoro-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 158134110 |
| Molecular Formula | C19H20F4O3S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-fluoro-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]-2-(trifluoromethoxy)benzene |
| SMILES | CC(C)S(=O)(=O)Cc1ccc(CCc2ccc(F)c(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H20F4O3S/c1-13(2)27(24,25)12-16-7-4-14(5-8-16)3-6-15-9-10-17(20)18(11-15)26-19(21,22)23/h4-5,7-11,13H,3,6,12H2,1-2H3 |
| InChIKey | FQMCPPKFMRQPNN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |