C19H23FO2S — CID 159128494
2-fluoro-1-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzene (PubChem CID 159128494) has the molecular formula C19H23FO2S and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-fluoro-1-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzene.
| Compound Name | 2-fluoro-1-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 159128494 |
| Molecular Formula | C19H23FO2S |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-fluoro-1-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzene |
| SMILES | Cc1ccc(CCc2ccc(CS(=O)(=O)C(C)C)cc2)cc1F |
| InChI | InChI=1S/C19H23FO2S/c1-14(2)23(21,22)13-18-10-7-16(8-11-18)6-9-17-5-4-15(3)19(20)12-17/h4-5,7-8,10-12,14H,6,9,13H2,1-3H3 |
| InChIKey | DWQIFGHIDRBZSS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |