C12H16F3NO3S — CID 106723037
N-(2-propan-2-ylsulfonylethyl)-2-(trifluoromethoxy)aniline (PubChem CID 106723037) has the molecular formula C12H16F3NO3S and a molecular weight of 311.32 g/mol. Its IUPAC name is N-(2-propan-2-ylsulfonylethyl)-2-(trifluoromethoxy)aniline.
| Compound Name | N-(2-propan-2-ylsulfonylethyl)-2-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 106723037 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(2-propan-2-ylsulfonylethyl)-2-(trifluoromethoxy)aniline |
| SMILES | CC(C)S(=O)(=O)CCNc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3S/c1-9(2)20(17,18)8-7-16-10-5-3-4-6-11(10)19-12(13,14)15/h3-6,9,16H,7-8H2,1-2H3 |
| InChIKey | LMIHNZIXMLSTGY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |