C23H25F4N3O2S — CID 158135950
[2-(3-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(1-methylidene-1-oxothian-4-yl)methanone (PubChem CID 158135950) has the molecular formula C23H25F4N3O2S and a molecular weight of 483.53 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(1-methylidene-1-oxothian-4-yl)methanone.
| Compound Name | [2-(3-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(1-methylidene-1-oxothian-4-yl)methanone |
|---|---|
| PubChem CID | 158135950 |
| Molecular Formula | C23H25F4N3O2S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [2-(3-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-(1-methylidene-1-oxothian-4-yl)methanone |
| SMILES | C=S1(=O)CCC(C(=O)N2CCN(c3ccc(C(F)(F)F)cn3)CC2c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H25F4N3O2S/c1-33(32)11-7-16(8-12-33)22(31)30-10-9-29(15-20(30)17-3-2-4-19(24)13-17)21-6-5-18(14-28-21)23(25,26)27/h2-6,13-14,16,20H,1,7-12,15H2 |
| InChIKey | PFQSWTXAMOJGQT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|