C28H29FN4O6S2 — CID 158136152
2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-morpholin-4-ylpropylamino)-4H-isoquinoline-1,3-dione (PubChem CID 158136152) has the molecular formula C28H29FN4O6S2 and a molecular weight of 600.69 g/mol. Its IUPAC name is 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-morpholin-4-ylpropylamino)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-morpholin-4-ylpropylamino)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 158136152 |
| Molecular Formula | C28H29FN4O6S2 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-morpholin-4-ylpropylamino)-4H-isoquinoline-1,3-dione |
| SMILES | O=C(Cc1ccc(N2C(=O)Cc3cc(NCCCN4CCOCC4)ccc3C2=O)nc1)CS(=O)(=O)c1ccc(F)s1 |
| InChI | InChI=1S/C28H29FN4O6S2/c29-24-5-7-27(40-24)41(37,38)18-22(34)14-19-2-6-25(31-17-19)33-26(35)16-20-15-21(3-4-23(20)28(33)36)30-8-1-9-32-10-12-39-13-11-32/h2-7,15,17,30H,1,8-14,16,18H2 |
| InChIKey | OHKZXIZXDUIVPY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|