About 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine
2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 158142260) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine.
Analyze 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine?
The IUPAC name of 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine (CID 158142260) is 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine.
What is the SMILES notation for 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine?
The canonical SMILES for 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine is C=CC1=NC(C)CC(C)N1.
What is the InChIKey of 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine?
The InChIKey is FUBXIGFJVKHUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8-9-6(2)5-7(3)10-8/h4,6-7H,1,5H2,2-3H3,(H,9,10).
What are the key properties of 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine?
2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine has a molecular weight of 138.21 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4,6-dimethyl-1,4,5,6-tetrahydropyrimidine is sourced from PubChem (CID 158142260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).