About (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline
(E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline (PubChem CID 158143559) has the molecular formula C20H23N3O4
and a molecular weight of 369.42 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline |
| PubChem CID | 158143559 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline |
| SMILES | CN1C2CCC1CN(c1ccc3ccccc3n1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H19N3.C4H4O4/c1-18-13-7-8-14(18)11-19(10-13)16-9-6-12-4-2-3-5-15(12)17-16;5-3(6)1-2-4(7)8/h2-6,9,13-14H,7-8,10-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FUFWLEJKQGHVKG-WLHGVMLRSA-N |
| XLogP | 2.23 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline?
The IUPAC name of (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline (CID 158143559) is (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline.
What is the SMILES notation for (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline?
The canonical SMILES for (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline is CN1C2CCC1CN(c1ccc3ccccc3n1)C2.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline?
The InChIKey is FUFWLEJKQGHVKG-WLHGVMLRSA-N. The full InChI is InChI=1S/C16H19N3.C4H4O4/c1-18-13-7-8-14(18)11-19(10-13)16-9-6-12-4-2-3-5-15(12)17-16;5-3(6)1-2-4(7)8/h2-6,9,13-14H,7-8,10-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline?
(E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline has a molecular weight of 369.42 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoline is sourced from PubChem (CID 158143559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).